C18H14Cl2N4O2S — CID 17311642
2,6-dichloro-N-[2-[(5-ethyl-1,3,4-thiadiazol-2-yl)carbamoyl]phenyl]benzamide (PubChem CID 17311642) has the molecular formula C18H14Cl2N4O2S and a molecular weight of 421.31 g/mol. Its IUPAC name is 2,6-dichloro-N-[2-[(5-ethyl-1,3,4-thiadiazol-2-yl)carbamoyl]phenyl]benzamide.
| Compound Name | 2,6-dichloro-N-[2-[(5-ethyl-1,3,4-thiadiazol-2-yl)carbamoyl]phenyl]benzamide |
|---|---|
| PubChem CID | 17311642 |
| Molecular Formula | C18H14Cl2N4O2S |
| Molecular Weight | 421.31 g/mol |
| Exact Mass | 420.02 |
| IUPAC Name | 2,6-dichloro-N-[2-[(5-ethyl-1,3,4-thiadiazol-2-yl)carbamoyl]phenyl]benzamide |
| SMILES | CCc1nnc(NC(=O)c2ccccc2NC(=O)c2c(Cl)cccc2Cl)s1 |
| InChI | InChI=1S/C18H14Cl2N4O2S/c1-2-14-23-24-18(27-14)22-16(25)10-6-3-4-9-13(10)21-17(26)15-11(19)7-5-8-12(15)20/h3-9H,2H2,1H3,(H,21,26)(H,22,24,25) |
| InChIKey | JVLAXQJPNCUINE-UHFFFAOYSA-N |
| XLogP | 4.91 |
| TPSA | 83.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.31 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |