C11H11ClN4OS — CID 82546737
2-amino-3-chloro-N-(5-ethyl-1,3,4-thiadiazol-2-yl)benzamide (PubChem CID 82546737) has the molecular formula C11H11ClN4OS and a molecular weight of 282.76 g/mol. Its IUPAC name is 2-amino-3-chloro-N-(5-ethyl-1,3,4-thiadiazol-2-yl)benzamide.
| Compound Name | 2-amino-3-chloro-N-(5-ethyl-1,3,4-thiadiazol-2-yl)benzamide |
|---|---|
| PubChem CID | 82546737 |
| Molecular Formula | C11H11ClN4OS |
| Molecular Weight | 282.76 g/mol |
| Exact Mass | 282.03 |
| IUPAC Name | 2-amino-3-chloro-N-(5-ethyl-1,3,4-thiadiazol-2-yl)benzamide |
| SMILES | CCc1nnc(NC(=O)c2cccc(Cl)c2N)s1 |
| InChI | InChI=1S/C11H11ClN4OS/c1-2-8-15-16-11(18-8)14-10(17)6-4-3-5-7(12)9(6)13/h3-5H,2,13H2,1H3,(H,14,16,17) |
| InChIKey | SWTDQGFCUVCFPP-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 80.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.76 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|