C11H8Cl2IN3OS — CID 5168739
3,5-dichloro-N-(5-ethyl-1,3,4-thiadiazol-2-yl)-2-iodobenzamide (PubChem CID 5168739) has the molecular formula C11H8Cl2IN3OS and a molecular weight of 428.08 g/mol. Its IUPAC name is 3,5-dichloro-N-(5-ethyl-1,3,4-thiadiazol-2-yl)-2-iodobenzamide.
| Compound Name | 3,5-dichloro-N-(5-ethyl-1,3,4-thiadiazol-2-yl)-2-iodobenzamide |
|---|---|
| PubChem CID | 5168739 |
| Molecular Formula | C11H8Cl2IN3OS |
| Molecular Weight | 428.08 g/mol |
| Exact Mass | 426.88 |
| IUPAC Name | 3,5-dichloro-N-(5-ethyl-1,3,4-thiadiazol-2-yl)-2-iodobenzamide |
| SMILES | CCc1nnc(NC(=O)c2cc(Cl)cc(Cl)c2I)s1 |
| InChI | InChI=1S/C11H8Cl2IN3OS/c1-2-8-16-17-11(19-8)15-10(18)6-3-5(12)4-7(13)9(6)14/h3-4H,2H2,1H3,(H,15,17,18) |
| InChIKey | NSKLUGBSRHJIFH-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.08 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|