C10H8Cl2N4OS — CID 82176238
N-[5-(aminomethyl)-1,3,4-thiadiazol-2-yl]-2,5-dichlorobenzamide (PubChem CID 82176238) has the molecular formula C10H8Cl2N4OS and a molecular weight of 303.17 g/mol. Its IUPAC name is N-[5-(aminomethyl)-1,3,4-thiadiazol-2-yl]-2,5-dichlorobenzamide.
| Compound Name | N-[5-(aminomethyl)-1,3,4-thiadiazol-2-yl]-2,5-dichlorobenzamide |
|---|---|
| PubChem CID | 82176238 |
| Molecular Formula | C10H8Cl2N4OS |
| Molecular Weight | 303.17 g/mol |
| Exact Mass | 301.98 |
| IUPAC Name | N-[5-(aminomethyl)-1,3,4-thiadiazol-2-yl]-2,5-dichlorobenzamide |
| SMILES | NCc1nnc(NC(=O)c2cc(Cl)ccc2Cl)s1 |
| InChI | InChI=1S/C10H8Cl2N4OS/c11-5-1-2-7(12)6(3-5)9(17)14-10-16-15-8(4-13)18-10/h1-3H,4,13H2,(H,14,16,17) |
| InChIKey | MVUAMQLBZNJDOQ-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 80.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.17 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |