C12H10Cl2N4OS2 — CID 54787210
2,4-dichloro-N-[(5-ethyl-1,3,4-thiadiazol-2-yl)carbamothioyl]benzamide (PubChem CID 54787210) has the molecular formula C12H10Cl2N4OS2 and a molecular weight of 361.28 g/mol. Its IUPAC name is 2,4-dichloro-N-[(5-ethyl-1,3,4-thiadiazol-2-yl)carbamothioyl]benzamide.
| Compound Name | 2,4-dichloro-N-[(5-ethyl-1,3,4-thiadiazol-2-yl)carbamothioyl]benzamide |
|---|---|
| PubChem CID | 54787210 |
| Molecular Formula | C12H10Cl2N4OS2 |
| Molecular Weight | 361.28 g/mol |
| Exact Mass | 359.97 |
| IUPAC Name | 2,4-dichloro-N-[(5-ethyl-1,3,4-thiadiazol-2-yl)carbamothioyl]benzamide |
| SMILES | CCc1nnc(NC(=S)NC(=O)c2ccc(Cl)cc2Cl)s1 |
| InChI | InChI=1S/C12H10Cl2N4OS2/c1-2-9-17-18-12(21-9)16-11(20)15-10(19)7-4-3-6(13)5-8(7)14/h3-5H,2H2,1H3,(H2,15,16,18,19,20) |
| InChIKey | RXGRZMYVFWDQCR-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 66.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.28 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|