C12H11ClN4O3S — CID 107642603
2-chloro-4-[(5-ethyl-1,3,4-thiadiazol-2-yl)carbamoylamino]benzoic acid (PubChem CID 107642603) has the molecular formula C12H11ClN4O3S and a molecular weight of 326.77 g/mol. Its IUPAC name is 2-chloro-4-[(5-ethyl-1,3,4-thiadiazol-2-yl)carbamoylamino]benzoic acid.
| Compound Name | 2-chloro-4-[(5-ethyl-1,3,4-thiadiazol-2-yl)carbamoylamino]benzoic acid |
|---|---|
| PubChem CID | 107642603 |
| Molecular Formula | C12H11ClN4O3S |
| Molecular Weight | 326.77 g/mol |
| Exact Mass | 326.02 |
| IUPAC Name | 2-chloro-4-[(5-ethyl-1,3,4-thiadiazol-2-yl)carbamoylamino]benzoic acid |
| SMILES | CCc1nnc(NC(=O)Nc2ccc(C(=O)O)c(Cl)c2)s1 |
| InChI | InChI=1S/C12H11ClN4O3S/c1-2-9-16-17-12(21-9)15-11(20)14-6-3-4-7(10(18)19)8(13)5-6/h3-5H,2H2,1H3,(H,18,19)(H2,14,15,17,20) |
| InChIKey | BTDCXUZCEJJWLX-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 104.21 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.77 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |