C11H10ClFN4S2 — CID 21008669
1-(3-chloro-4-fluorophenyl)-3-(5-ethyl-1,3,4-thiadiazol-2-yl)thiourea (PubChem CID 21008669) has the molecular formula C11H10ClFN4S2 and a molecular weight of 316.81 g/mol. Its IUPAC name is 1-(3-chloro-4-fluorophenyl)-3-(5-ethyl-1,3,4-thiadiazol-2-yl)thiourea.
| Compound Name | 1-(3-chloro-4-fluorophenyl)-3-(5-ethyl-1,3,4-thiadiazol-2-yl)thiourea |
|---|---|
| PubChem CID | 21008669 |
| Molecular Formula | C11H10ClFN4S2 |
| Molecular Weight | 316.81 g/mol |
| Exact Mass | 316.00 |
| IUPAC Name | 1-(3-chloro-4-fluorophenyl)-3-(5-ethyl-1,3,4-thiadiazol-2-yl)thiourea |
| SMILES | CCc1nnc(NC(=S)Nc2ccc(F)c(Cl)c2)s1 |
| InChI | InChI=1S/C11H10ClFN4S2/c1-2-9-16-17-11(19-9)15-10(18)14-6-3-4-8(13)7(12)5-6/h3-5H,2H2,1H3,(H2,14,15,17,18) |
| InChIKey | GRNLMAFNLQMKNS-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 49.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.81 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|