C15H14ClFN2O2S2 — CID 17299369
methyl 2-[(3-chloro-4-fluorophenyl)carbamothioylamino]-5-ethylthiophene-3-carboxylate (PubChem CID 17299369) has the molecular formula C15H14ClFN2O2S2 and a molecular weight of 372.87 g/mol. Its IUPAC name is methyl 2-[(3-chloro-4-fluorophenyl)carbamothioylamino]-5-ethylthiophene-3-carboxylate.
| Compound Name | methyl 2-[(3-chloro-4-fluorophenyl)carbamothioylamino]-5-ethylthiophene-3-carboxylate |
|---|---|
| PubChem CID | 17299369 |
| Molecular Formula | C15H14ClFN2O2S2 |
| Molecular Weight | 372.87 g/mol |
| Exact Mass | 372.02 |
| IUPAC Name | methyl 2-[(3-chloro-4-fluorophenyl)carbamothioylamino]-5-ethylthiophene-3-carboxylate |
| SMILES | CCc1cc(C(=O)OC)c(NC(=S)Nc2ccc(F)c(Cl)c2)s1 |
| InChI | InChI=1S/C15H14ClFN2O2S2/c1-3-9-7-10(14(20)21-2)13(23-9)19-15(22)18-8-4-5-12(17)11(16)6-8/h4-7H,3H2,1-2H3,(H2,18,19,22) |
| InChIKey | XVEKAKWVVAEREJ-UHFFFAOYSA-N |
| XLogP | 4.70 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.87 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|