C19H23N3O4S3 — CID 19680487
methyl 5-ethyl-2-[(4-pyrrolidin-1-ylsulfonylphenyl)carbamothioylamino]thiophene-3-carboxylate (PubChem CID 19680487) has the molecular formula C19H23N3O4S3 and a molecular weight of 453.61 g/mol. Its IUPAC name is methyl 5-ethyl-2-[(4-pyrrolidin-1-ylsulfonylphenyl)carbamothioylamino]thiophene-3-carboxylate.
| Compound Name | methyl 5-ethyl-2-[(4-pyrrolidin-1-ylsulfonylphenyl)carbamothioylamino]thiophene-3-carboxylate |
|---|---|
| PubChem CID | 19680487 |
| Molecular Formula | C19H23N3O4S3 |
| Molecular Weight | 453.61 g/mol |
| Exact Mass | 453.09 |
| IUPAC Name | methyl 5-ethyl-2-[(4-pyrrolidin-1-ylsulfonylphenyl)carbamothioylamino]thiophene-3-carboxylate |
| SMILES | CCc1cc(C(=O)OC)c(NC(=S)Nc2ccc(S(=O)(=O)N3CCCC3)cc2)s1 |
| InChI | InChI=1S/C19H23N3O4S3/c1-3-14-12-16(18(23)26-2)17(28-14)21-19(27)20-13-6-8-15(9-7-13)29(24,25)22-10-4-5-11-22/h6-9,12H,3-5,10-11H2,1-2H3,(H2,20,21,27) |
| InChIKey | UCMQUWMAIFVOHA-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.61 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|