C22H23N3O4S3 — CID 100572293
methyl 5-[(4-pyrrolidin-1-ylsulfonylphenyl)methylcarbamothioylamino]-1-benzothiophene-2-carboxylate (PubChem CID 100572293) has the molecular formula C22H23N3O4S3 and a molecular weight of 489.64 g/mol. Its IUPAC name is methyl 5-[(4-pyrrolidin-1-ylsulfonylphenyl)methylcarbamothioylamino]-1-benzothiophene-2-carboxylate.
| Compound Name | methyl 5-[(4-pyrrolidin-1-ylsulfonylphenyl)methylcarbamothioylamino]-1-benzothiophene-2-carboxylate |
|---|---|
| PubChem CID | 100572293 |
| Molecular Formula | C22H23N3O4S3 |
| Molecular Weight | 489.64 g/mol |
| Exact Mass | 489.09 |
| IUPAC Name | methyl 5-[(4-pyrrolidin-1-ylsulfonylphenyl)methylcarbamothioylamino]-1-benzothiophene-2-carboxylate |
| SMILES | COC(=O)c1cc2cc(NC(=S)NCc3ccc(S(=O)(=O)N4CCCC4)cc3)ccc2s1 |
| InChI | InChI=1S/C22H23N3O4S3/c1-29-21(26)20-13-16-12-17(6-9-19(16)31-20)24-22(30)23-14-15-4-7-18(8-5-15)32(27,28)25-10-2-3-11-25/h4-9,12-13H,2-3,10-11,14H2,1H3,(H2,23,24,30) |
| InChIKey | FYDMLRHWGVTOLN-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.64 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|