C14H16N2O3S2 — CID 100567892
methyl 5-(3-hydroxypropylcarbamothioylamino)-1-benzothiophene-2-carboxylate (PubChem CID 100567892) has the molecular formula C14H16N2O3S2 and a molecular weight of 324.43 g/mol. Its IUPAC name is methyl 5-(3-hydroxypropylcarbamothioylamino)-1-benzothiophene-2-carboxylate.
| Compound Name | methyl 5-(3-hydroxypropylcarbamothioylamino)-1-benzothiophene-2-carboxylate |
|---|---|
| PubChem CID | 100567892 |
| Molecular Formula | C14H16N2O3S2 |
| Molecular Weight | 324.43 g/mol |
| Exact Mass | 324.06 |
| IUPAC Name | methyl 5-(3-hydroxypropylcarbamothioylamino)-1-benzothiophene-2-carboxylate |
| SMILES | COC(=O)c1cc2cc(NC(=S)NCCCO)ccc2s1 |
| InChI | InChI=1S/C14H16N2O3S2/c1-19-13(18)12-8-9-7-10(3-4-11(9)21-12)16-14(20)15-5-2-6-17/h3-4,7-8,17H,2,5-6H2,1H3,(H2,15,16,20) |
| InChIKey | KWLRUMYURBSQHA-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 70.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.43 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|