C23H28N4O5S — CID 156577875
tert-butyl N-[5-[[2-(3-hydroxypropylcarbamoyl)-1-benzothiophen-5-yl]carbamoyl]-1-methylpyrrol-3-yl]carbamate (PubChem CID 156577875) has the molecular formula C23H28N4O5S and a molecular weight of 472.57 g/mol. Its IUPAC name is tert-butyl N-[5-[[2-(3-hydroxypropylcarbamoyl)-1-benzothiophen-5-yl]carbamoyl]-1-methylpyrrol-3-yl]carbamate.
| Compound Name | tert-butyl N-[5-[[2-(3-hydroxypropylcarbamoyl)-1-benzothiophen-5-yl]carbamoyl]-1-methylpyrrol-3-yl]carbamate |
|---|---|
| PubChem CID | 156577875 |
| Molecular Formula | C23H28N4O5S |
| Molecular Weight | 472.57 g/mol |
| Exact Mass | 472.18 |
| IUPAC Name | tert-butyl N-[5-[[2-(3-hydroxypropylcarbamoyl)-1-benzothiophen-5-yl]carbamoyl]-1-methylpyrrol-3-yl]carbamate |
| SMILES | Cn1cc(NC(=O)OC(C)(C)C)cc1C(=O)Nc1ccc2sc(C(=O)NCCCO)cc2c1 |
| InChI | InChI=1S/C23H28N4O5S/c1-23(2,3)32-22(31)26-16-12-17(27(4)13-16)20(29)25-15-6-7-18-14(10-15)11-19(33-18)21(30)24-8-5-9-28/h6-7,10-13,28H,5,8-9H2,1-4H3,(H,24,30)(H,25,29)(H,26,31) |
| InChIKey | WBWFSJFTERKTFH-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 121.69 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.57 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|