C19H26N6O6 — CID 67389280
tert-butyl N-[2-[[1-methyl-4-[(1-methyl-4-nitropyrrole-2-carbonyl)amino]pyrrole-2-carbonyl]amino]ethyl]carbamate (PubChem CID 67389280) has the molecular formula C19H26N6O6 and a molecular weight of 434.45 g/mol. Its IUPAC name is tert-butyl N-[2-[[1-methyl-4-[(1-methyl-4-nitropyrrole-2-carbonyl)amino]pyrrole-2-carbonyl]amino]ethyl]carbamate.
| Compound Name | tert-butyl N-[2-[[1-methyl-4-[(1-methyl-4-nitropyrrole-2-carbonyl)amino]pyrrole-2-carbonyl]amino]ethyl]carbamate |
|---|---|
| PubChem CID | 67389280 |
| Molecular Formula | C19H26N6O6 |
| Molecular Weight | 434.45 g/mol |
| Exact Mass | 434.19 |
| IUPAC Name | tert-butyl N-[2-[[1-methyl-4-[(1-methyl-4-nitropyrrole-2-carbonyl)amino]pyrrole-2-carbonyl]amino]ethyl]carbamate |
| SMILES | Cn1cc(NC(=O)c2cc([N+](=O)[O-])cn2C)cc1C(=O)NCCNC(=O)OC(C)(C)C |
| InChI | InChI=1S/C19H26N6O6/c1-19(2,3)31-18(28)21-7-6-20-16(26)14-8-12(10-23(14)4)22-17(27)15-9-13(25(29)30)11-24(15)5/h8-11H,6-7H2,1-5H3,(H,20,26)(H,21,28)(H,22,27) |
| InChIKey | XHZQRQGYFAMGBH-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 149.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.45 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|