C18H25N7O4 — CID 170326149
N-(6-amino-6-iminohexyl)-1-methyl-4-[(1-methyl-4-nitropyrrole-2-carbonyl)amino]pyrrole-2-carboxamide (PubChem CID 170326149) has the molecular formula C18H25N7O4 and a molecular weight of 403.44 g/mol. Its IUPAC name is N-(6-amino-6-iminohexyl)-1-methyl-4-[(1-methyl-4-nitropyrrole-2-carbonyl)amino]pyrrole-2-carboxamide.
| Compound Name | N-(6-amino-6-iminohexyl)-1-methyl-4-[(1-methyl-4-nitropyrrole-2-carbonyl)amino]pyrrole-2-carboxamide |
|---|---|
| PubChem CID | 170326149 |
| Molecular Formula | C18H25N7O4 |
| Molecular Weight | 403.44 g/mol |
| Exact Mass | 403.20 |
| IUPAC Name | N-(6-amino-6-iminohexyl)-1-methyl-4-[(1-methyl-4-nitropyrrole-2-carbonyl)amino]pyrrole-2-carboxamide |
| SMILES | [H]/N=C(\N)CCCCCNC(=O)c1cc(NC(=O)c2cc([N+](=O)[O-])cn2C)cn1C |
| InChI | InChI=1S/C18H25N7O4/c1-23-10-12(22-18(27)15-9-13(25(28)29)11-24(15)2)8-14(23)17(26)21-7-5-3-4-6-16(19)20/h8-11H,3-7H2,1-2H3,(H3,19,20)(H,21,26)(H,22,27) |
| InChIKey | TXNYJFLSHYZVFC-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 161.07 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.44 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|