C20H24N10O5 — CID 18916562
N-[5-[[5-[(3-amino-3-iminopropyl)carbamoyl]-1-methylpyrrol-3-yl]carbamoyl]-1-methylpyrrol-3-yl]-1-methyl-3-nitropyrazole-5-carboxamide (PubChem CID 18916562) has the molecular formula C20H24N10O5 and a molecular weight of 484.48 g/mol. Its IUPAC name is N-[5-[[5-[(3-amino-3-iminopropyl)carbamoyl]-1-methylpyrrol-3-yl]carbamoyl]-1-methylpyrrol-3-yl]-1-methyl-3-nitropyrazole-5-carboxamide.
| Compound Name | N-[5-[[5-[(3-amino-3-iminopropyl)carbamoyl]-1-methylpyrrol-3-yl]carbamoyl]-1-methylpyrrol-3-yl]-1-methyl-3-nitropyrazole-5-carboxamide |
|---|---|
| PubChem CID | 18916562 |
| Molecular Formula | C20H24N10O5 |
| Molecular Weight | 484.48 g/mol |
| Exact Mass | 484.19 |
| IUPAC Name | N-[5-[[5-[(3-amino-3-iminopropyl)carbamoyl]-1-methylpyrrol-3-yl]carbamoyl]-1-methylpyrrol-3-yl]-1-methyl-3-nitropyrazole-5-carboxamide |
| SMILES | [H]/N=C(\N)CCNC(=O)c1cc(NC(=O)c2cc(NC(=O)c3cc([N+](=O)[O-])nn3C)cn2C)cn1C |
| InChI | InChI=1S/C20H24N10O5/c1-27-9-11(6-13(27)18(31)23-5-4-16(21)22)24-19(32)14-7-12(10-28(14)2)25-20(33)15-8-17(30(34)35)26-29(15)3/h6-10H,4-5H2,1-3H3,(H3,21,22)(H,23,31)(H,24,32)(H,25,33) |
| InChIKey | HNSGRBWPFMCNRK-UHFFFAOYSA-N |
| XLogP | 0.57 |
| TPSA | 207.99 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.48 |
| LogP ≤ 5 | 0.57 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|