C30H35ClN10O4 — CID 11764667
N-[5-[[5-[(3-amino-3-iminopropyl)carbamoyl]-1-methylpyrrol-3-yl]carbamoyl]-1-methylpyrrol-3-yl]-4-[[4-(2-chloroethylamino)benzoyl]amino]-1-methylpyrrole-2-carboxamide (PubChem CID 11764667) has the molecular formula C30H35ClN10O4 and a molecular weight of 635.13 g/mol. Its IUPAC name is N-[5-[[5-[(3-amino-3-iminopropyl)carbamoyl]-1-methylpyrrol-3-yl]carbamoyl]-1-methylpyrrol-3-yl]-4-[[4-(2-chloroethylamino)benzoyl]amino]-1-methylpyrrole-2-carboxamide.
| Compound Name | N-[5-[[5-[(3-amino-3-iminopropyl)carbamoyl]-1-methylpyrrol-3-yl]carbamoyl]-1-methylpyrrol-3-yl]-4-[[4-(2-chloroethylamino)benzoyl]amino]-1-methylpyrrole-2-carboxamide |
|---|---|
| PubChem CID | 11764667 |
| Molecular Formula | C30H35ClN10O4 |
| Molecular Weight | 635.13 g/mol |
| Exact Mass | 634.25 |
| IUPAC Name | N-[5-[[5-[(3-amino-3-iminopropyl)carbamoyl]-1-methylpyrrol-3-yl]carbamoyl]-1-methylpyrrol-3-yl]-4-[[4-(2-chloroethylamino)benzoyl]amino]-1-methylpyrrole-2-carboxamide |
| SMILES | [H]/N=C(\N)CCNC(=O)c1cc(NC(=O)c2cc(NC(=O)c3cc(NC(=O)c4ccc(NCCCl)cc4)cn3C)cn2C)cn1C |
| InChI | InChI=1S/C30H35ClN10O4/c1-39-16-21(12-23(39)28(43)35-10-8-26(32)33)37-30(45)25-14-22(17-41(25)3)38-29(44)24-13-20(15-40(24)2)36-27(42)18-4-6-19(7-5-18)34-11-9-31/h4-7,12-17,34H,8-11H2,1-3H3,(H3,32,33)(H,35,43)(H,36,42)(H,37,45)(H,38,44) |
| InChIKey | PBRCWWVWHOXGJL-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 193.09 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 635.13 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|