C15H19N7O4 — CID 14039039
N-(3-amino-3-iminopropyl)-1-methyl-4-[(1-methyl-4-nitropyrrole-2-carbonyl)amino]pyrrole-2-carboxamide (PubChem CID 14039039) has the molecular formula C15H19N7O4 and a molecular weight of 361.36 g/mol. Its IUPAC name is N-(3-amino-3-iminopropyl)-1-methyl-4-[(1-methyl-4-nitropyrrole-2-carbonyl)amino]pyrrole-2-carboxamide.
| Compound Name | N-(3-amino-3-iminopropyl)-1-methyl-4-[(1-methyl-4-nitropyrrole-2-carbonyl)amino]pyrrole-2-carboxamide |
|---|---|
| PubChem CID | 14039039 |
| Molecular Formula | C15H19N7O4 |
| Molecular Weight | 361.36 g/mol |
| Exact Mass | 361.15 |
| IUPAC Name | N-(3-amino-3-iminopropyl)-1-methyl-4-[(1-methyl-4-nitropyrrole-2-carbonyl)amino]pyrrole-2-carboxamide |
| SMILES | [H]/N=C(\N)CCNC(=O)c1cc(NC(=O)c2cc([N+](=O)[O-])cn2C)cn1C |
| InChI | InChI=1S/C15H19N7O4/c1-20-7-9(5-11(20)14(23)18-4-3-13(16)17)19-15(24)12-6-10(22(25)26)8-21(12)2/h5-8H,3-4H2,1-2H3,(H3,16,17)(H,18,23)(H,19,24) |
| InChIKey | GPMPQMAABOKVML-UHFFFAOYSA-N |
| XLogP | 0.58 |
| TPSA | 161.07 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.36 |
| LogP ≤ 5 | 0.58 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|