C20H30N8O4 — CID 170326162
N-[3-amino-3-[3-(dimethylamino)propylimino]propyl]-1-methyl-4-[(1-methyl-4-nitropyrrole-2-carbonyl)amino]pyrrole-2-carboxamide (PubChem CID 170326162) has the molecular formula C20H30N8O4 and a molecular weight of 446.51 g/mol. Its IUPAC name is N-[3-amino-3-[3-(dimethylamino)propylimino]propyl]-1-methyl-4-[(1-methyl-4-nitropyrrole-2-carbonyl)amino]pyrrole-2-carboxamide.
| Compound Name | N-[3-amino-3-[3-(dimethylamino)propylimino]propyl]-1-methyl-4-[(1-methyl-4-nitropyrrole-2-carbonyl)amino]pyrrole-2-carboxamide |
|---|---|
| PubChem CID | 170326162 |
| Molecular Formula | C20H30N8O4 |
| Molecular Weight | 446.51 g/mol |
| Exact Mass | 446.24 |
| IUPAC Name | N-[3-amino-3-[3-(dimethylamino)propylimino]propyl]-1-methyl-4-[(1-methyl-4-nitropyrrole-2-carbonyl)amino]pyrrole-2-carboxamide |
| SMILES | CN(C)CCC/N=C(\N)CCNC(=O)c1cc(NC(=O)c2cc([N+](=O)[O-])cn2C)cn1C |
| InChI | InChI=1S/C20H30N8O4/c1-25(2)9-5-7-22-18(21)6-8-23-19(29)16-10-14(12-26(16)3)24-20(30)17-11-15(28(31)32)13-27(17)4/h10-13H,5-9H2,1-4H3,(H2,21,22)(H,23,29)(H,24,30) |
| InChIKey | ABGHBRMOUNZENX-UHFFFAOYSA-N |
| XLogP | 0.95 |
| TPSA | 152.82 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.51 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|