C21H25N9O6 — CID 142656951
N-[2-(carbamoylamino)ethyl]-1-methyl-4-[[1-methyl-4-[(1-methyl-4-nitropyrrole-2-carbonyl)amino]pyrrole-2-carbonyl]amino]pyrrole-2-carboxamide (PubChem CID 142656951) has the molecular formula C21H25N9O6 and a molecular weight of 499.49 g/mol. Its IUPAC name is N-[2-(carbamoylamino)ethyl]-1-methyl-4-[[1-methyl-4-[(1-methyl-4-nitropyrrole-2-carbonyl)amino]pyrrole-2-carbonyl]amino]pyrrole-2-carboxamide.
| Compound Name | N-[2-(carbamoylamino)ethyl]-1-methyl-4-[[1-methyl-4-[(1-methyl-4-nitropyrrole-2-carbonyl)amino]pyrrole-2-carbonyl]amino]pyrrole-2-carboxamide |
|---|---|
| PubChem CID | 142656951 |
| Molecular Formula | C21H25N9O6 |
| Molecular Weight | 499.49 g/mol |
| Exact Mass | 499.19 |
| IUPAC Name | N-[2-(carbamoylamino)ethyl]-1-methyl-4-[[1-methyl-4-[(1-methyl-4-nitropyrrole-2-carbonyl)amino]pyrrole-2-carbonyl]amino]pyrrole-2-carboxamide |
| SMILES | Cn1cc(NC(=O)c2cc(NC(=O)c3cc([N+](=O)[O-])cn3C)cn2C)cc1C(=O)NCCNC(N)=O |
| InChI | InChI=1S/C21H25N9O6/c1-27-9-12(6-15(27)18(31)23-4-5-24-21(22)34)25-19(32)16-7-13(10-28(16)2)26-20(33)17-8-14(30(35)36)11-29(17)3/h6-11H,4-5H2,1-3H3,(H,23,31)(H,25,32)(H,26,33)(H3,22,24,34) |
| InChIKey | TWELPYARQYPBNB-UHFFFAOYSA-N |
| XLogP | 0.51 |
| TPSA | 200.35 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.49 |
| LogP ≤ 5 | 0.51 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|