C10H14BrN3O3 — CID 106845787
N-(4-bromobutyl)-1-methyl-4-nitropyrrole-2-carboxamide (PubChem CID 106845787) has the molecular formula C10H14BrN3O3 and a molecular weight of 304.14 g/mol. Its IUPAC name is N-(4-bromobutyl)-1-methyl-4-nitropyrrole-2-carboxamide.
| Compound Name | N-(4-bromobutyl)-1-methyl-4-nitropyrrole-2-carboxamide |
|---|---|
| PubChem CID | 106845787 |
| Molecular Formula | C10H14BrN3O3 |
| Molecular Weight | 304.14 g/mol |
| Exact Mass | 303.02 |
| IUPAC Name | N-(4-bromobutyl)-1-methyl-4-nitropyrrole-2-carboxamide |
| SMILES | Cn1cc([N+](=O)[O-])cc1C(=O)NCCCCBr |
| InChI | InChI=1S/C10H14BrN3O3/c1-13-7-8(14(16)17)6-9(13)10(15)12-5-3-2-4-11/h6-7H,2-5H2,1H3,(H,12,15) |
| InChIKey | RRAGTZYJFDUQRH-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 77.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.14 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|