C13H20BrN3O3 — CID 107156485
N-(2-bromo-4,4-dimethylpentyl)-1-methyl-4-nitropyrrole-2-carboxamide (PubChem CID 107156485) has the molecular formula C13H20BrN3O3 and a molecular weight of 346.23 g/mol. Its IUPAC name is N-(2-bromo-4,4-dimethylpentyl)-1-methyl-4-nitropyrrole-2-carboxamide.
| Compound Name | N-(2-bromo-4,4-dimethylpentyl)-1-methyl-4-nitropyrrole-2-carboxamide |
|---|---|
| PubChem CID | 107156485 |
| Molecular Formula | C13H20BrN3O3 |
| Molecular Weight | 346.23 g/mol |
| Exact Mass | 345.07 |
| IUPAC Name | N-(2-bromo-4,4-dimethylpentyl)-1-methyl-4-nitropyrrole-2-carboxamide |
| SMILES | Cn1cc([N+](=O)[O-])cc1C(=O)NCC(Br)CC(C)(C)C |
| InChI | InChI=1S/C13H20BrN3O3/c1-13(2,3)6-9(14)7-15-12(18)11-5-10(17(19)20)8-16(11)4/h5,8-9H,6-7H2,1-4H3,(H,15,18) |
| InChIKey | SSIMOVDIEGUZJZ-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 77.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.23 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|