C10H14BrN3O4 — CID 106184509
N-(1-bromo-3-methoxypropan-2-yl)-1-methyl-4-nitropyrrole-2-carboxamide (PubChem CID 106184509) has the molecular formula C10H14BrN3O4 and a molecular weight of 320.14 g/mol. Its IUPAC name is N-(1-bromo-3-methoxypropan-2-yl)-1-methyl-4-nitropyrrole-2-carboxamide.
| Compound Name | N-(1-bromo-3-methoxypropan-2-yl)-1-methyl-4-nitropyrrole-2-carboxamide |
|---|---|
| PubChem CID | 106184509 |
| Molecular Formula | C10H14BrN3O4 |
| Molecular Weight | 320.14 g/mol |
| Exact Mass | 319.02 |
| IUPAC Name | N-(1-bromo-3-methoxypropan-2-yl)-1-methyl-4-nitropyrrole-2-carboxamide |
| SMILES | COCC(CBr)NC(=O)c1cc([N+](=O)[O-])cn1C |
| InChI | InChI=1S/C10H14BrN3O4/c1-13-5-8(14(16)17)3-9(13)10(15)12-7(4-11)6-18-2/h3,5,7H,4,6H2,1-2H3,(H,12,15) |
| InChIKey | VBTTVJATCKTTTP-UHFFFAOYSA-N |
| XLogP | 1.07 |
| TPSA | 86.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.14 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|