C10H13N3O5 — CID 60701979
methyl 2-[(1-methyl-4-nitropyrrole-2-carbonyl)amino]propanoate (PubChem CID 60701979) has the molecular formula C10H13N3O5 and a molecular weight of 255.23 g/mol. Its IUPAC name is methyl 2-[(1-methyl-4-nitropyrrole-2-carbonyl)amino]propanoate.
| Compound Name | methyl 2-[(1-methyl-4-nitropyrrole-2-carbonyl)amino]propanoate |
|---|---|
| PubChem CID | 60701979 |
| Molecular Formula | C10H13N3O5 |
| Molecular Weight | 255.23 g/mol |
| Exact Mass | 255.09 |
| IUPAC Name | methyl 2-[(1-methyl-4-nitropyrrole-2-carbonyl)amino]propanoate |
| SMILES | COC(=O)C(C)NC(=O)c1cc([N+](=O)[O-])cn1C |
| InChI | InChI=1S/C10H13N3O5/c1-6(10(15)18-3)11-9(14)8-4-7(13(16)17)5-12(8)2/h4-6H,1-3H3,(H,11,14) |
| InChIKey | PZXYXULBNRIOHA-UHFFFAOYSA-N |
| XLogP | 0.22 |
| TPSA | 103.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.23 |
| LogP ≤ 5 | 0.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|