C11H16BrN3O4 — CID 114151305
N-(4-bromo-1-methoxybutan-2-yl)-1-methyl-5-nitropyrrole-2-carboxamide (PubChem CID 114151305) has the molecular formula C11H16BrN3O4 and a molecular weight of 334.17 g/mol. Its IUPAC name is N-(4-bromo-1-methoxybutan-2-yl)-1-methyl-5-nitropyrrole-2-carboxamide.
| Compound Name | N-(4-bromo-1-methoxybutan-2-yl)-1-methyl-5-nitropyrrole-2-carboxamide |
|---|---|
| PubChem CID | 114151305 |
| Molecular Formula | C11H16BrN3O4 |
| Molecular Weight | 334.17 g/mol |
| Exact Mass | 333.03 |
| IUPAC Name | N-(4-bromo-1-methoxybutan-2-yl)-1-methyl-5-nitropyrrole-2-carboxamide |
| SMILES | COCC(CCBr)NC(=O)c1ccc([N+](=O)[O-])n1C |
| InChI | InChI=1S/C11H16BrN3O4/c1-14-9(3-4-10(14)15(17)18)11(16)13-8(5-6-12)7-19-2/h3-4,8H,5-7H2,1-2H3,(H,13,16) |
| InChIKey | RXDVMURGTYMSML-UHFFFAOYSA-N |
| XLogP | 1.46 |
| TPSA | 86.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.17 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|