C14H20BrNO4 — CID 106156481
N-(4-bromo-1-methoxybutan-2-yl)-3,5-dimethoxybenzamide (PubChem CID 106156481) has the molecular formula C14H20BrNO4 and a molecular weight of 346.22 g/mol. Its IUPAC name is N-(4-bromo-1-methoxybutan-2-yl)-3,5-dimethoxybenzamide.
| Compound Name | N-(4-bromo-1-methoxybutan-2-yl)-3,5-dimethoxybenzamide |
|---|---|
| PubChem CID | 106156481 |
| Molecular Formula | C14H20BrNO4 |
| Molecular Weight | 346.22 g/mol |
| Exact Mass | 345.06 |
| IUPAC Name | N-(4-bromo-1-methoxybutan-2-yl)-3,5-dimethoxybenzamide |
| SMILES | COCC(CCBr)NC(=O)c1cc(OC)cc(OC)c1 |
| InChI | InChI=1S/C14H20BrNO4/c1-18-9-11(4-5-15)16-14(17)10-6-12(19-2)8-13(7-10)20-3/h6-8,11H,4-5,9H2,1-3H3,(H,16,17) |
| InChIKey | RFDSQFNRJREVCK-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.22 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|