C16H17Br2NO2 — CID 106156588
6-bromo-N-(4-bromo-1-methoxybutan-2-yl)naphthalene-2-carboxamide (PubChem CID 106156588) has the molecular formula C16H17Br2NO2 and a molecular weight of 415.13 g/mol. Its IUPAC name is 6-bromo-N-(4-bromo-1-methoxybutan-2-yl)naphthalene-2-carboxamide.
| Compound Name | 6-bromo-N-(4-bromo-1-methoxybutan-2-yl)naphthalene-2-carboxamide |
|---|---|
| PubChem CID | 106156588 |
| Molecular Formula | C16H17Br2NO2 |
| Molecular Weight | 415.13 g/mol |
| Exact Mass | 412.96 |
| IUPAC Name | 6-bromo-N-(4-bromo-1-methoxybutan-2-yl)naphthalene-2-carboxamide |
| SMILES | COCC(CCBr)NC(=O)c1ccc2cc(Br)ccc2c1 |
| InChI | InChI=1S/C16H17Br2NO2/c1-21-10-15(6-7-17)19-16(20)13-3-2-12-9-14(18)5-4-11(12)8-13/h2-5,8-9,15H,6-7,10H2,1H3,(H,19,20) |
| InChIKey | PJMDKXNIRQVANO-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.13 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|