C11H12BrFN2O4 — CID 106184238
N-(1-bromo-3-methoxypropan-2-yl)-3-fluoro-5-nitrobenzamide (PubChem CID 106184238) has the molecular formula C11H12BrFN2O4 and a molecular weight of 335.13 g/mol. Its IUPAC name is N-(1-bromo-3-methoxypropan-2-yl)-3-fluoro-5-nitrobenzamide.
| Compound Name | N-(1-bromo-3-methoxypropan-2-yl)-3-fluoro-5-nitrobenzamide |
|---|---|
| PubChem CID | 106184238 |
| Molecular Formula | C11H12BrFN2O4 |
| Molecular Weight | 335.13 g/mol |
| Exact Mass | 334.00 |
| IUPAC Name | N-(1-bromo-3-methoxypropan-2-yl)-3-fluoro-5-nitrobenzamide |
| SMILES | COCC(CBr)NC(=O)c1cc(F)cc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C11H12BrFN2O4/c1-19-6-9(5-12)14-11(16)7-2-8(13)4-10(3-7)15(17)18/h2-4,9H,5-6H2,1H3,(H,14,16) |
| InChIKey | VZMDISJXESMMEA-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 81.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.13 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|