C12H14BrFN2O3 — CID 113276022
N-(1-bromo-3-methylbutan-2-yl)-3-fluoro-5-nitrobenzamide (PubChem CID 113276022) has the molecular formula C12H14BrFN2O3 and a molecular weight of 333.16 g/mol. Its IUPAC name is N-(1-bromo-3-methylbutan-2-yl)-3-fluoro-5-nitrobenzamide.
| Compound Name | N-(1-bromo-3-methylbutan-2-yl)-3-fluoro-5-nitrobenzamide |
|---|---|
| PubChem CID | 113276022 |
| Molecular Formula | C12H14BrFN2O3 |
| Molecular Weight | 333.16 g/mol |
| Exact Mass | 332.02 |
| IUPAC Name | N-(1-bromo-3-methylbutan-2-yl)-3-fluoro-5-nitrobenzamide |
| SMILES | CC(C)C(CBr)NC(=O)c1cc(F)cc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C12H14BrFN2O3/c1-7(2)11(6-13)15-12(17)8-3-9(14)5-10(4-8)16(18)19/h3-5,7,11H,6H2,1-2H3,(H,15,17) |
| InChIKey | NDXFUMBPXFXIJR-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 72.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.16 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|