C13H13FN2O3 — CID 103528571
3-fluoro-N-hex-1-yn-3-yl-5-nitrobenzamide (PubChem CID 103528571) has the molecular formula C13H13FN2O3 and a molecular weight of 264.26 g/mol. Its IUPAC name is 3-fluoro-N-hex-1-yn-3-yl-5-nitrobenzamide.
| Compound Name | 3-fluoro-N-hex-1-yn-3-yl-5-nitrobenzamide |
|---|---|
| PubChem CID | 103528571 |
| Molecular Formula | C13H13FN2O3 |
| Molecular Weight | 264.26 g/mol |
| Exact Mass | 264.09 |
| IUPAC Name | 3-fluoro-N-hex-1-yn-3-yl-5-nitrobenzamide |
| SMILES | C#CC(CCC)NC(=O)c1cc(F)cc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C13H13FN2O3/c1-3-5-11(4-2)15-13(17)9-6-10(14)8-12(7-9)16(18)19/h2,6-8,11H,3,5H2,1H3,(H,15,17) |
| InChIKey | HUWOHFQGHMNJMP-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 72.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.26 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|