C14H17N3O3 — CID 106228226
1-cyclopropyl-N-hex-1-yn-3-yl-4-nitropyrrole-2-carboxamide (PubChem CID 106228226) has the molecular formula C14H17N3O3 and a molecular weight of 275.31 g/mol. Its IUPAC name is 1-cyclopropyl-N-hex-1-yn-3-yl-4-nitropyrrole-2-carboxamide.
| Compound Name | 1-cyclopropyl-N-hex-1-yn-3-yl-4-nitropyrrole-2-carboxamide |
|---|---|
| PubChem CID | 106228226 |
| Molecular Formula | C14H17N3O3 |
| Molecular Weight | 275.31 g/mol |
| Exact Mass | 275.13 |
| IUPAC Name | 1-cyclopropyl-N-hex-1-yn-3-yl-4-nitropyrrole-2-carboxamide |
| SMILES | C#CC(CCC)NC(=O)c1cc([N+](=O)[O-])cn1C1CC1 |
| InChI | InChI=1S/C14H17N3O3/c1-3-5-10(4-2)15-14(18)13-8-12(17(19)20)9-16(13)11-6-7-11/h2,8-11H,3,5-7H2,1H3,(H,15,18) |
| InChIKey | FSXGQRHKGXFWKK-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 77.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.31 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|