C11H15N3O5 — CID 66176627
1-cyclopropyl-N-(2,3-dihydroxypropyl)-4-nitropyrrole-2-carboxamide (PubChem CID 66176627) has the molecular formula C11H15N3O5 and a molecular weight of 269.26 g/mol. Its IUPAC name is 1-cyclopropyl-N-(2,3-dihydroxypropyl)-4-nitropyrrole-2-carboxamide.
| Compound Name | 1-cyclopropyl-N-(2,3-dihydroxypropyl)-4-nitropyrrole-2-carboxamide |
|---|---|
| PubChem CID | 66176627 |
| Molecular Formula | C11H15N3O5 |
| Molecular Weight | 269.26 g/mol |
| Exact Mass | 269.10 |
| IUPAC Name | 1-cyclopropyl-N-(2,3-dihydroxypropyl)-4-nitropyrrole-2-carboxamide |
| SMILES | O=C(NCC(O)CO)c1cc([N+](=O)[O-])cn1C1CC1 |
| InChI | InChI=1S/C11H15N3O5/c15-6-9(16)4-12-11(17)10-3-8(14(18)19)5-13(10)7-1-2-7/h3,5,7,9,15-16H,1-2,4,6H2,(H,12,17) |
| InChIKey | OMZOURUGKWSRLT-UHFFFAOYSA-N |
| XLogP | -0.19 |
| TPSA | 117.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.26 |
| LogP ≤ 5 | -0.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|