C12H16N2O7 — CID 18429365
3-(1,2-dihydroxyethyl)-N-(2,3-dihydroxypropyl)-5-nitrobenzamide (PubChem CID 18429365) has the molecular formula C12H16N2O7 and a molecular weight of 300.27 g/mol. Its IUPAC name is 3-(1,2-dihydroxyethyl)-N-(2,3-dihydroxypropyl)-5-nitrobenzamide.
| Compound Name | 3-(1,2-dihydroxyethyl)-N-(2,3-dihydroxypropyl)-5-nitrobenzamide |
|---|---|
| PubChem CID | 18429365 |
| Molecular Formula | C12H16N2O7 |
| Molecular Weight | 300.27 g/mol |
| Exact Mass | 300.10 |
| IUPAC Name | 3-(1,2-dihydroxyethyl)-N-(2,3-dihydroxypropyl)-5-nitrobenzamide |
| SMILES | O=C(NCC(O)CO)c1cc(C(O)CO)cc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C12H16N2O7/c15-5-10(17)4-13-12(19)8-1-7(11(18)6-16)2-9(3-8)14(20)21/h1-3,10-11,15-18H,4-6H2,(H,13,19) |
| InChIKey | BTZPMOKLVIGIFN-UHFFFAOYSA-N |
| XLogP | -1.30 |
| TPSA | 153.16 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.27 |
| LogP ≤ 5 | -1.30 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|