C9H11BrN2O5 — CID 106184442
N-(1-bromo-3-methoxypropan-2-yl)-5-nitrofuran-2-carboxamide (PubChem CID 106184442) has the molecular formula C9H11BrN2O5 and a molecular weight of 307.10 g/mol. Its IUPAC name is N-(1-bromo-3-methoxypropan-2-yl)-5-nitrofuran-2-carboxamide.
| Compound Name | N-(1-bromo-3-methoxypropan-2-yl)-5-nitrofuran-2-carboxamide |
|---|---|
| PubChem CID | 106184442 |
| Molecular Formula | C9H11BrN2O5 |
| Molecular Weight | 307.10 g/mol |
| Exact Mass | 305.99 |
| IUPAC Name | N-(1-bromo-3-methoxypropan-2-yl)-5-nitrofuran-2-carboxamide |
| SMILES | COCC(CBr)NC(=O)c1ccc([N+](=O)[O-])o1 |
| InChI | InChI=1S/C9H11BrN2O5/c1-16-5-6(4-10)11-9(13)7-2-3-8(17-7)12(14)15/h2-3,6H,4-5H2,1H3,(H,11,13) |
| InChIKey | OPKDQMCHHUXZDK-UHFFFAOYSA-N |
| XLogP | 1.33 |
| TPSA | 94.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.10 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|