C10H14BrNO3 — CID 106184775
N-(1-bromo-3-methoxypropan-2-yl)-5-methylfuran-2-carboxamide (PubChem CID 106184775) has the molecular formula C10H14BrNO3 and a molecular weight of 276.13 g/mol. Its IUPAC name is N-(1-bromo-3-methoxypropan-2-yl)-5-methylfuran-2-carboxamide.
| Compound Name | N-(1-bromo-3-methoxypropan-2-yl)-5-methylfuran-2-carboxamide |
|---|---|
| PubChem CID | 106184775 |
| Molecular Formula | C10H14BrNO3 |
| Molecular Weight | 276.13 g/mol |
| Exact Mass | 275.02 |
| IUPAC Name | N-(1-bromo-3-methoxypropan-2-yl)-5-methylfuran-2-carboxamide |
| SMILES | COCC(CBr)NC(=O)c1ccc(C)o1 |
| InChI | InChI=1S/C10H14BrNO3/c1-7-3-4-9(15-7)10(13)12-8(5-11)6-14-2/h3-4,8H,5-6H2,1-2H3,(H,12,13) |
| InChIKey | BTPOPJXOQMUPLW-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 51.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.13 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|