C14H14BrNO2 — CID 114311008
N-(2-bromo-1-phenylethyl)-5-methylfuran-2-carboxamide (PubChem CID 114311008) has the molecular formula C14H14BrNO2 and a molecular weight of 308.18 g/mol. Its IUPAC name is N-(2-bromo-1-phenylethyl)-5-methylfuran-2-carboxamide.
| Compound Name | N-(2-bromo-1-phenylethyl)-5-methylfuran-2-carboxamide |
|---|---|
| PubChem CID | 114311008 |
| Molecular Formula | C14H14BrNO2 |
| Molecular Weight | 308.18 g/mol |
| Exact Mass | 307.02 |
| IUPAC Name | N-(2-bromo-1-phenylethyl)-5-methylfuran-2-carboxamide |
| SMILES | Cc1ccc(C(=O)NC(CBr)c2ccccc2)o1 |
| InChI | InChI=1S/C14H14BrNO2/c1-10-7-8-13(18-10)14(17)16-12(9-15)11-5-3-2-4-6-11/h2-8,12H,9H2,1H3,(H,16,17) |
| InChIKey | OEQBBRZVDLGYIK-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 42.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.18 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|