C16H16BrNO2 — CID 107673091
N-(2-bromo-1-phenylethyl)-4-hydroxy-2-methylbenzamide (PubChem CID 107673091) has the molecular formula C16H16BrNO2 and a molecular weight of 334.21 g/mol. Its IUPAC name is N-(2-bromo-1-phenylethyl)-4-hydroxy-2-methylbenzamide.
| Compound Name | N-(2-bromo-1-phenylethyl)-4-hydroxy-2-methylbenzamide |
|---|---|
| PubChem CID | 107673091 |
| Molecular Formula | C16H16BrNO2 |
| Molecular Weight | 334.21 g/mol |
| Exact Mass | 333.04 |
| IUPAC Name | N-(2-bromo-1-phenylethyl)-4-hydroxy-2-methylbenzamide |
| SMILES | Cc1cc(O)ccc1C(=O)NC(CBr)c1ccccc1 |
| InChI | InChI=1S/C16H16BrNO2/c1-11-9-13(19)7-8-14(11)16(20)18-15(10-17)12-5-3-2-4-6-12/h2-9,15,19H,10H2,1H3,(H,18,20) |
| InChIKey | BMLMWXGMFNWBKH-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.21 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|