C17H20N2O2 — CID 102705550
5-amino-N-(2-hydroxy-1-phenylethyl)-2,4-dimethylbenzamide (PubChem CID 102705550) has the molecular formula C17H20N2O2 and a molecular weight of 284.36 g/mol. Its IUPAC name is 5-amino-N-(2-hydroxy-1-phenylethyl)-2,4-dimethylbenzamide.
| Compound Name | 5-amino-N-(2-hydroxy-1-phenylethyl)-2,4-dimethylbenzamide |
|---|---|
| PubChem CID | 102705550 |
| Molecular Formula | C17H20N2O2 |
| Molecular Weight | 284.36 g/mol |
| Exact Mass | 284.15 |
| IUPAC Name | 5-amino-N-(2-hydroxy-1-phenylethyl)-2,4-dimethylbenzamide |
| SMILES | Cc1cc(C)c(C(=O)NC(CO)c2ccccc2)cc1N |
| InChI | InChI=1S/C17H20N2O2/c1-11-8-12(2)15(18)9-14(11)17(21)19-16(10-20)13-6-4-3-5-7-13/h3-9,16,20H,10,18H2,1-2H3,(H,19,21) |
| InChIKey | SHXMETRHYGQRFR-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 75.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.36 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|