C21H27NO — CID 100710084
2,4,5-trimethyl-N-[(1S)-3-methyl-1-phenylbutyl]benzamide (PubChem CID 100710084) has the molecular formula C21H27NO and a molecular weight of 309.45 g/mol. Its IUPAC name is 2,4,5-trimethyl-N-[(1S)-3-methyl-1-phenylbutyl]benzamide.
| Compound Name | 2,4,5-trimethyl-N-[(1S)-3-methyl-1-phenylbutyl]benzamide |
|---|---|
| PubChem CID | 100710084 |
| Molecular Formula | C21H27NO |
| Molecular Weight | 309.45 g/mol |
| Exact Mass | 309.21 |
| IUPAC Name | 2,4,5-trimethyl-N-[(1S)-3-methyl-1-phenylbutyl]benzamide |
| SMILES | Cc1cc(C)c(C(=O)N[C@@H](CC(C)C)c2ccccc2)cc1C |
| InChI | InChI=1S/C21H27NO/c1-14(2)11-20(18-9-7-6-8-10-18)22-21(23)19-13-16(4)15(3)12-17(19)5/h6-10,12-14,20H,11H2,1-5H3,(H,22,23)/t20-/m0/s1 |
| InChIKey | LNOSVYTTZFKJHF-FQEVSTJZSA-N |
| XLogP | 5.13 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.45 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |