C22H29NO — CID 133187263
3-(3,4-dimethylphenyl)-N-(3-methyl-1-phenylbutyl)propanamide (PubChem CID 133187263) has the molecular formula C22H29NO and a molecular weight of 323.48 g/mol. Its IUPAC name is 3-(3,4-dimethylphenyl)-N-(3-methyl-1-phenylbutyl)propanamide.
| Compound Name | 3-(3,4-dimethylphenyl)-N-(3-methyl-1-phenylbutyl)propanamide |
|---|---|
| PubChem CID | 133187263 |
| Molecular Formula | C22H29NO |
| Molecular Weight | 323.48 g/mol |
| Exact Mass | 323.22 |
| IUPAC Name | 3-(3,4-dimethylphenyl)-N-(3-methyl-1-phenylbutyl)propanamide |
| SMILES | Cc1ccc(CCC(=O)NC(CC(C)C)c2ccccc2)cc1C |
| InChI | InChI=1S/C22H29NO/c1-16(2)14-21(20-8-6-5-7-9-20)23-22(24)13-12-19-11-10-17(3)18(4)15-19/h5-11,15-16,21H,12-14H2,1-4H3,(H,23,24) |
| InChIKey | JOABVVSKHVWNKJ-UHFFFAOYSA-N |
| XLogP | 5.14 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.48 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |