C25H27NO — CID 133186877
3-(3,4-dimethylphenyl)-N-[(4-methylphenyl)-phenylmethyl]propanamide (PubChem CID 133186877) has the molecular formula C25H27NO and a molecular weight of 357.50 g/mol. Its IUPAC name is 3-(3,4-dimethylphenyl)-N-[(4-methylphenyl)-phenylmethyl]propanamide.
| Compound Name | 3-(3,4-dimethylphenyl)-N-[(4-methylphenyl)-phenylmethyl]propanamide |
|---|---|
| PubChem CID | 133186877 |
| Molecular Formula | C25H27NO |
| Molecular Weight | 357.50 g/mol |
| Exact Mass | 357.21 |
| IUPAC Name | 3-(3,4-dimethylphenyl)-N-[(4-methylphenyl)-phenylmethyl]propanamide |
| SMILES | Cc1ccc(C(NC(=O)CCc2ccc(C)c(C)c2)c2ccccc2)cc1 |
| InChI | InChI=1S/C25H27NO/c1-18-9-14-23(15-10-18)25(22-7-5-4-6-8-22)26-24(27)16-13-21-12-11-19(2)20(3)17-21/h4-12,14-15,17,25H,13,16H2,1-3H3,(H,26,27) |
| InChIKey | XOUBKYUATSGMPW-UHFFFAOYSA-N |
| XLogP | 5.45 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.50 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |