C22H18F3NO — CID 55609022
3-(3,4-difluorophenyl)-N-[(4-fluorophenyl)-phenylmethyl]propanamide (PubChem CID 55609022) has the molecular formula C22H18F3NO and a molecular weight of 369.39 g/mol. Its IUPAC name is 3-(3,4-difluorophenyl)-N-[(4-fluorophenyl)-phenylmethyl]propanamide.
| Compound Name | 3-(3,4-difluorophenyl)-N-[(4-fluorophenyl)-phenylmethyl]propanamide |
|---|---|
| PubChem CID | 55609022 |
| Molecular Formula | C22H18F3NO |
| Molecular Weight | 369.39 g/mol |
| Exact Mass | 369.13 |
| IUPAC Name | 3-(3,4-difluorophenyl)-N-[(4-fluorophenyl)-phenylmethyl]propanamide |
| SMILES | O=C(CCc1ccc(F)c(F)c1)NC(c1ccccc1)c1ccc(F)cc1 |
| InChI | InChI=1S/C22H18F3NO/c23-18-10-8-17(9-11-18)22(16-4-2-1-3-5-16)26-21(27)13-7-15-6-12-19(24)20(25)14-15/h1-6,8-12,14,22H,7,13H2,(H,26,27) |
| InChIKey | LUQYNXJKSIAKPS-UHFFFAOYSA-N |
| XLogP | 4.94 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.39 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |