C19H20F3NO — CID 86894208
N-[4-(3,4-difluorophenyl)butan-2-yl]-3-(3-fluorophenyl)propanamide (PubChem CID 86894208) has the molecular formula C19H20F3NO and a molecular weight of 335.37 g/mol. Its IUPAC name is N-[4-(3,4-difluorophenyl)butan-2-yl]-3-(3-fluorophenyl)propanamide.
| Compound Name | N-[4-(3,4-difluorophenyl)butan-2-yl]-3-(3-fluorophenyl)propanamide |
|---|---|
| PubChem CID | 86894208 |
| Molecular Formula | C19H20F3NO |
| Molecular Weight | 335.37 g/mol |
| Exact Mass | 335.15 |
| IUPAC Name | N-[4-(3,4-difluorophenyl)butan-2-yl]-3-(3-fluorophenyl)propanamide |
| SMILES | CC(CCc1ccc(F)c(F)c1)NC(=O)CCc1cccc(F)c1 |
| InChI | InChI=1S/C19H20F3NO/c1-13(5-6-15-7-9-17(21)18(22)12-15)23-19(24)10-8-14-3-2-4-16(20)11-14/h2-4,7,9,11-13H,5-6,8,10H2,1H3,(H,23,24) |
| InChIKey | GAPSAHFCTUBYTD-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.37 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |