C22H27F2NO4 — CID 86894232
N-[4-(3,4-difluorophenyl)butan-2-yl]-3-(3,4,5-trimethoxyphenyl)propanamide (PubChem CID 86894232) has the molecular formula C22H27F2NO4 and a molecular weight of 407.46 g/mol. Its IUPAC name is N-[4-(3,4-difluorophenyl)butan-2-yl]-3-(3,4,5-trimethoxyphenyl)propanamide.
| Compound Name | N-[4-(3,4-difluorophenyl)butan-2-yl]-3-(3,4,5-trimethoxyphenyl)propanamide |
|---|---|
| PubChem CID | 86894232 |
| Molecular Formula | C22H27F2NO4 |
| Molecular Weight | 407.46 g/mol |
| Exact Mass | 407.19 |
| IUPAC Name | N-[4-(3,4-difluorophenyl)butan-2-yl]-3-(3,4,5-trimethoxyphenyl)propanamide |
| SMILES | COc1cc(CCC(=O)NC(C)CCc2ccc(F)c(F)c2)cc(OC)c1OC |
| InChI | InChI=1S/C22H27F2NO4/c1-14(5-6-15-7-9-17(23)18(24)11-15)25-21(26)10-8-16-12-19(27-2)22(29-4)20(13-16)28-3/h7,9,11-14H,5-6,8,10H2,1-4H3,(H,25,26) |
| InChIKey | YVUZHLGSXQBYRA-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.46 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |