C15H19F2NO3 — CID 107144250
(2S)-2-[3-(3,4-difluorophenyl)propanoylamino]hexanoic acid (PubChem CID 107144250) has the molecular formula C15H19F2NO3 and a molecular weight of 299.32 g/mol. Its IUPAC name is (2S)-2-[3-(3,4-difluorophenyl)propanoylamino]hexanoic acid.
| Compound Name | (2S)-2-[3-(3,4-difluorophenyl)propanoylamino]hexanoic acid |
|---|---|
| PubChem CID | 107144250 |
| Molecular Formula | C15H19F2NO3 |
| Molecular Weight | 299.32 g/mol |
| Exact Mass | 299.13 |
| IUPAC Name | (2S)-2-[3-(3,4-difluorophenyl)propanoylamino]hexanoic acid |
| SMILES | CCCC[C@H](NC(=O)CCc1ccc(F)c(F)c1)C(=O)O |
| InChI | InChI=1S/C15H19F2NO3/c1-2-3-4-13(15(20)21)18-14(19)8-6-10-5-7-11(16)12(17)9-10/h5,7,9,13H,2-4,6,8H2,1H3,(H,18,19)(H,20,21)/t13-/m0/s1 |
| InChIKey | DKDOCIJIILJMRV-ZDUSSCGKSA-N |
| XLogP | 2.66 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.32 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |