C14H18F2N2O3 — CID 155171207
2-[[(2S)-2-aminopropanoyl]amino]-5-(3,4-difluorophenyl)pentanoic acid (PubChem CID 155171207) has the molecular formula C14H18F2N2O3 and a molecular weight of 300.31 g/mol. Its IUPAC name is 2-[[(2S)-2-aminopropanoyl]amino]-5-(3,4-difluorophenyl)pentanoic acid.
| Compound Name | 2-[[(2S)-2-aminopropanoyl]amino]-5-(3,4-difluorophenyl)pentanoic acid |
|---|---|
| PubChem CID | 155171207 |
| Molecular Formula | C14H18F2N2O3 |
| Molecular Weight | 300.31 g/mol |
| Exact Mass | 300.13 |
| IUPAC Name | 2-[[(2S)-2-aminopropanoyl]amino]-5-(3,4-difluorophenyl)pentanoic acid |
| SMILES | C[C@H](N)C(=O)NC(CCCc1ccc(F)c(F)c1)C(=O)O |
| InChI | InChI=1S/C14H18F2N2O3/c1-8(17)13(19)18-12(14(20)21)4-2-3-9-5-6-10(15)11(16)7-9/h5-8,12H,2-4,17H2,1H3,(H,18,19)(H,20,21)/t8-,12?/m0/s1 |
| InChIKey | QSUQPJZGTWZIPY-KBPLZSHQSA-N |
| XLogP | 1.20 |
| TPSA | 92.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.31 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |