C17H25FN2O3 — CID 155171140
2-[[(2S)-2-aminohexanoyl]amino]-5-(4-fluorophenyl)pentanoic acid (PubChem CID 155171140) has the molecular formula C17H25FN2O3 and a molecular weight of 324.40 g/mol. Its IUPAC name is 2-[[(2S)-2-aminohexanoyl]amino]-5-(4-fluorophenyl)pentanoic acid.
| Compound Name | 2-[[(2S)-2-aminohexanoyl]amino]-5-(4-fluorophenyl)pentanoic acid |
|---|---|
| PubChem CID | 155171140 |
| Molecular Formula | C17H25FN2O3 |
| Molecular Weight | 324.40 g/mol |
| Exact Mass | 324.18 |
| IUPAC Name | 2-[[(2S)-2-aminohexanoyl]amino]-5-(4-fluorophenyl)pentanoic acid |
| SMILES | CCCC[C@H](N)C(=O)NC(CCCc1ccc(F)cc1)C(=O)O |
| InChI | InChI=1S/C17H25FN2O3/c1-2-3-6-14(19)16(21)20-15(17(22)23)7-4-5-12-8-10-13(18)11-9-12/h8-11,14-15H,2-7,19H2,1H3,(H,20,21)(H,22,23)/t14-,15?/m0/s1 |
| InChIKey | UVWREIKTWLILEF-MLCCFXAWSA-N |
| XLogP | 2.24 |
| TPSA | 92.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.40 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |