C15H21FN2O3 — CID 135362291
2-[[(2S)-2-aminohexanoyl]amino]-3-(3-fluorophenyl)propanoic acid (PubChem CID 135362291) has the molecular formula C15H21FN2O3 and a molecular weight of 296.34 g/mol. Its IUPAC name is 2-[[(2S)-2-aminohexanoyl]amino]-3-(3-fluorophenyl)propanoic acid.
| Compound Name | 2-[[(2S)-2-aminohexanoyl]amino]-3-(3-fluorophenyl)propanoic acid |
|---|---|
| PubChem CID | 135362291 |
| Molecular Formula | C15H21FN2O3 |
| Molecular Weight | 296.34 g/mol |
| Exact Mass | 296.15 |
| IUPAC Name | 2-[[(2S)-2-aminohexanoyl]amino]-3-(3-fluorophenyl)propanoic acid |
| SMILES | CCCC[C@H](N)C(=O)NC(Cc1cccc(F)c1)C(=O)O |
| InChI | InChI=1S/C15H21FN2O3/c1-2-3-7-12(17)14(19)18-13(15(20)21)9-10-5-4-6-11(16)8-10/h4-6,8,12-13H,2-3,7,9,17H2,1H3,(H,18,19)(H,20,21)/t12-,13?/m0/s1 |
| InChIKey | XFIXURXQZMEIEL-UEWDXFNNSA-N |
| XLogP | 1.46 |
| TPSA | 92.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.34 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |