C14H18FN3O4 — CID 155171159
2-[[(2S)-2,5-diamino-5-oxopentanoyl]amino]-3-(3-fluorophenyl)propanoic acid (PubChem CID 155171159) has the molecular formula C14H18FN3O4 and a molecular weight of 311.31 g/mol. Its IUPAC name is 2-[[(2S)-2,5-diamino-5-oxopentanoyl]amino]-3-(3-fluorophenyl)propanoic acid.
| Compound Name | 2-[[(2S)-2,5-diamino-5-oxopentanoyl]amino]-3-(3-fluorophenyl)propanoic acid |
|---|---|
| PubChem CID | 155171159 |
| Molecular Formula | C14H18FN3O4 |
| Molecular Weight | 311.31 g/mol |
| Exact Mass | 311.13 |
| IUPAC Name | 2-[[(2S)-2,5-diamino-5-oxopentanoyl]amino]-3-(3-fluorophenyl)propanoic acid |
| SMILES | NC(=O)CC[C@H](N)C(=O)NC(Cc1cccc(F)c1)C(=O)O |
| InChI | InChI=1S/C14H18FN3O4/c15-9-3-1-2-8(6-9)7-11(14(21)22)18-13(20)10(16)4-5-12(17)19/h1-3,6,10-11H,4-5,7,16H2,(H2,17,19)(H,18,20)(H,21,22)/t10-,11?/m0/s1 |
| InChIKey | MMPUEHBUGHIABL-VUWPPUDQSA-N |
| XLogP | -0.47 |
| TPSA | 135.51 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.31 |
| LogP ≤ 5 | -0.47 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |