C18H19FN2O4 — CID 135362117
2-[[2-amino-3-(4-hydroxyphenyl)propanoyl]amino]-3-(3-fluorophenyl)propanoic acid (PubChem CID 135362117) has the molecular formula C18H19FN2O4 and a molecular weight of 346.36 g/mol. Its IUPAC name is 2-[[2-amino-3-(4-hydroxyphenyl)propanoyl]amino]-3-(3-fluorophenyl)propanoic acid.
| Compound Name | 2-[[2-amino-3-(4-hydroxyphenyl)propanoyl]amino]-3-(3-fluorophenyl)propanoic acid |
|---|---|
| PubChem CID | 135362117 |
| Molecular Formula | C18H19FN2O4 |
| Molecular Weight | 346.36 g/mol |
| Exact Mass | 346.13 |
| IUPAC Name | 2-[[2-amino-3-(4-hydroxyphenyl)propanoyl]amino]-3-(3-fluorophenyl)propanoic acid |
| SMILES | NC(Cc1ccc(O)cc1)C(=O)NC(Cc1cccc(F)c1)C(=O)O |
| InChI | InChI=1S/C18H19FN2O4/c19-13-3-1-2-12(8-13)10-16(18(24)25)21-17(23)15(20)9-11-4-6-14(22)7-5-11/h1-8,15-16,22H,9-10,20H2,(H,21,23)(H,24,25) |
| InChIKey | YMGYZOXJOLNTIT-UHFFFAOYSA-N |
| XLogP | 1.21 |
| TPSA | 112.65 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.36 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |