C16H27N3O8 — CID 175745494
(2S)-2-[[(2S)-2-[[(2S)-2-aminohexanoyl]amino]-4-carboxybutanoyl]amino]pentanedioic acid (PubChem CID 175745494) has the molecular formula C16H27N3O8 and a molecular weight of 389.41 g/mol. Its IUPAC name is (2S)-2-[[(2S)-2-[[(2S)-2-aminohexanoyl]amino]-4-carboxybutanoyl]amino]pentanedioic acid.
| Compound Name | (2S)-2-[[(2S)-2-[[(2S)-2-aminohexanoyl]amino]-4-carboxybutanoyl]amino]pentanedioic acid |
|---|---|
| PubChem CID | 175745494 |
| Molecular Formula | C16H27N3O8 |
| Molecular Weight | 389.41 g/mol |
| Exact Mass | 389.18 |
| IUPAC Name | (2S)-2-[[(2S)-2-[[(2S)-2-aminohexanoyl]amino]-4-carboxybutanoyl]amino]pentanedioic acid |
| SMILES | CCCC[C@H](N)C(=O)N[C@@H](CCC(=O)O)C(=O)N[C@@H](CCC(=O)O)C(=O)O |
| InChI | InChI=1S/C16H27N3O8/c1-2-3-4-9(17)14(24)18-10(5-7-12(20)21)15(25)19-11(16(26)27)6-8-13(22)23/h9-11H,2-8,17H2,1H3,(H,18,24)(H,19,25)(H,20,21)(H,22,23)(H,26,27)/t9-,10-,11-/m0/s1 |
| InChIKey | QPHPQXKSPCIHOA-DCAQKATOSA-N |
| XLogP | -0.71 |
| TPSA | 196.12 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.41 |
| LogP ≤ 5 | -0.71 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |